C16H20ClN3O2 — CID 110881591
N-(3-chloro-4-cyanophenyl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]acetamide (PubChem CID 110881591) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 110881591 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-[2-(2-hydroxyethyl)piperidin-1-yl]acetamide |
| SMILES | N#Cc1ccc(NC(=O)CN2CCCCC2CCO)cc1Cl |
| InChI | InChI=1S/C16H20ClN3O2/c17-15-9-13(5-4-12(15)10-18)19-16(22)11-20-7-2-1-3-14(20)6-8-21/h4-5,9,14,21H,1-3,6-8,11H2,(H,19,22) |
| InChIKey | FZODBQKDKXWZJO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |