C21H27N3O3S — CID 86952115
3-[2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-N-(3-sulfamoylphenyl)propanamide (PubChem CID 86952115) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-[2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 86952115 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-[2-(3,5-dimethylphenyl)pyrrolidin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(C2CCCN2CCC(=O)Nc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-15-11-16(2)13-17(12-15)20-7-4-9-24(20)10-8-21(25)23-18-5-3-6-19(14-18)28(22,26)27/h3,5-6,11-14,20H,4,7-10H2,1-2H3,(H,23,25)(H2,22,26,27) |
| InChIKey | FQUWNHPKDXDWDY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |