C21H24N4O3S2 — CID 78830213
3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-sulfamoylphenyl)propanamide (PubChem CID 78830213) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 78830213 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 3-[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CCN2CCCCC2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C21H24N4O3S2/c22-30(27,28)16-7-5-6-15(14-16)23-20(26)11-13-25-12-4-3-9-18(25)21-24-17-8-1-2-10-19(17)29-21/h1-2,5-8,10,14,18H,3-4,9,11-13H2,(H,23,26)(H2,22,27,28) |
| InChIKey | HTLCNVYOQRHGFH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |