C17H24N6O3S — CID 120869826
3-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide (PubChem CID 120869826) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 3-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 120869826 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[2-(1-methylimidazol-2-yl)piperazin-1-yl]-N-(3-sulfamoylphenyl)propanamide |
| SMILES | Cn1ccnc1C1CNCCN1CCC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H24N6O3S/c1-22-9-7-20-17(22)15-12-19-6-10-23(15)8-5-16(24)21-13-3-2-4-14(11-13)27(18,25)26/h2-4,7,9,11,15,19H,5-6,8,10,12H2,1H3,(H,21,24)(H2,18,25,26) |
| InChIKey | RMMRJXBYWBTCRY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |