C20H27NOS — CID 92878166
(2R)-1-[(4-propoxyphenyl)methyl]-2-thiophen-2-ylazepane (PubChem CID 92878166) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is (2R)-1-[(4-propoxyphenyl)methyl]-2-thiophen-2-ylazepane.
| Compound Name | (2R)-1-[(4-propoxyphenyl)methyl]-2-thiophen-2-ylazepane |
|---|---|
| PubChem CID | 92878166 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | (2R)-1-[(4-propoxyphenyl)methyl]-2-thiophen-2-ylazepane |
| SMILES | CCCOc1ccc(CN2CCCCC[C@@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C20H27NOS/c1-2-14-22-18-11-9-17(10-12-18)16-21-13-5-3-4-7-19(21)20-8-6-15-23-20/h6,8-12,15,19H,2-5,7,13-14,16H2,1H3/t19-/m1/s1 |
| InChIKey | YSMYTPLGQWFXIA-LJQANCHMSA-N |
| XLogP | 5.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |