C16H17N5S — CID 125020229
2-[(2S)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine (PubChem CID 125020229) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[(2S)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-[(2S)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 125020229 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[(2S)-1-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine |
| SMILES | c1csc(-c2[nH]ncc2CN2CCC[C@H]2c2cnccn2)c1 |
| InChI | InChI=1S/C16H17N5S/c1-3-14(13-10-17-5-6-18-13)21(7-1)11-12-9-19-20-16(12)15-4-2-8-22-15/h2,4-6,8-10,14H,1,3,7,11H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | YBJFOPQTJPJITJ-AWEZNQCLSA-N |
| XLogP | 3.27 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |