C15H17N5S — CID 125009893
4-[[(3R)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1H-pyrazole (PubChem CID 125009893) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-[[(3R)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1H-pyrazole.
| Compound Name | 4-[[(3R)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1H-pyrazole |
|---|---|
| PubChem CID | 125009893 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[[(3R)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methyl]-5-thiophen-2-yl-1H-pyrazole |
| SMILES | c1csc(-c2[nH]ncc2CN2CC[C@@H](c3ccn[nH]3)C2)c1 |
| InChI | InChI=1S/C15H17N5S/c1-2-14(21-7-1)15-12(8-17-19-15)10-20-6-4-11(9-20)13-3-5-16-18-13/h1-3,5,7-8,11H,4,6,9-10H2,(H,16,18)(H,17,19)/t11-/m1/s1 |
| InChIKey | VFOVFKXSQXGEBS-LLVKDONJSA-N |
| XLogP | 2.85 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |