C16H17N5OS — CID 56753766
[3-(1H-pyrazol-5-yl)piperidin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone (PubChem CID 56753766) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is [3-(1H-pyrazol-5-yl)piperidin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone.
| Compound Name | [3-(1H-pyrazol-5-yl)piperidin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 56753766 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [3-(1H-pyrazol-5-yl)piperidin-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1-c1cccs1)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C16H17N5OS/c22-16(12-9-18-20-15(12)14-4-2-8-23-14)21-7-1-3-11(10-21)13-5-6-17-19-13/h2,4-6,8-9,11H,1,3,7,10H2,(H,17,19)(H,18,20) |
| InChIKey | UUQRJFZFWAKZQT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |