C14H14ClFN4O — CID 103892263
(2-chloro-5-fluoro-3-pyridinyl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 103892263) has the molecular formula C14H14ClFN4O and a molecular weight of 308.74 g/mol. Its IUPAC name is (2-chloro-5-fluoro-3-pyridinyl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-fluoro-3-pyridinyl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 103892263 |
| Molecular Formula | C14H14ClFN4O |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2-chloro-5-fluoro-3-pyridinyl)-[3-(1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(F)cnc1Cl)N1CCCC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C14H14ClFN4O/c15-13-11(6-10(16)7-17-13)14(21)20-5-1-2-9(8-20)12-3-4-18-19-12/h3-4,6-7,9H,1-2,5,8H2,(H,18,19) |
| InChIKey | MWHDLEPJMVMIAT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|