C16H21N5OS — CID 50978348
(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone (PubChem CID 50978348) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone.
| Compound Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 50978348 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
| SMILES | CN1CCN2CCN(C(=O)c3cn[nH]c3-c3cccs3)CC2C1 |
| InChI | InChI=1S/C16H21N5OS/c1-19-4-5-20-6-7-21(11-12(20)10-19)16(22)13-9-17-18-15(13)14-3-2-8-23-14/h2-3,8-9,12H,4-7,10-11H2,1H3,(H,17,18) |
| InChIKey | BYRKPKQQGXACTH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |