C17H21N3O3S — CID 118776041
[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone (PubChem CID 118776041) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone.
| Compound Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 118776041 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-thiophen-2-yl-1H-pyrazol-4-yl)methanone |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1cn[nH]c1-c1cccs1)CC2 |
| InChI | InChI=1S/C17H21N3O3S/c1-23-17-5-4-11(21)9-14(17)20(7-6-17)16(22)12-10-18-19-15(12)13-3-2-8-24-13/h2-3,8,10-11,14,21H,4-7,9H2,1H3,(H,18,19)/t11-,14-,17+/m0/s1 |
| InChIKey | OUDUSQVVYQWQNJ-PZSREKOKSA-N |
| XLogP | 2.28 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |