C19H23N3O3 — CID 118786394
[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone (PubChem CID 118786394) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 118786394 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[2-(1H-imidazol-2-yl)phenyl]methanone |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1ccccc1-c1ncc[nH]1)CC2 |
| InChI | InChI=1S/C19H23N3O3/c1-25-19-7-6-13(23)12-16(19)22(11-8-19)18(24)15-5-3-2-4-14(15)17-20-9-10-21-17/h2-5,9-10,13,16,23H,6-8,11-12H2,1H3,(H,20,21)/t13-,16-,19+/m0/s1 |
| InChIKey | JNNWEQYOTKLOGI-IYJAJMOOSA-N |
| XLogP | 2.22 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |