C20H24N2O4 — CID 118794406
3-[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1-methylquinolin-2-one (PubChem CID 118794406) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1-methylquinolin-2-one.
| Compound Name | 3-[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 118794406 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1-methylquinolin-2-one |
| SMILES | CO[C@@]12CC[C@@H](O)C[C@@H]1N(C(=O)c1cc3ccccc3n(C)c1=O)CC2 |
| InChI | InChI=1S/C20H24N2O4/c1-21-16-6-4-3-5-13(16)11-15(18(21)24)19(25)22-10-9-20(26-2)8-7-14(23)12-17(20)22/h3-6,11,14,17,23H,7-10,12H2,1-2H3/t14-,17+,20-/m1/s1 |
| InChIKey | HDDBHAQCDJJAMA-CFLQYTFWSA-N |
| XLogP | 1.68 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |