C20H27N3O3 — CID 118772404
1-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-3-(2-methylbenzimidazol-1-yl)propan-1-one (PubChem CID 118772404) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-3-(2-methylbenzimidazol-1-yl)propan-1-one.
| Compound Name | 1-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-3-(2-methylbenzimidazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 118772404 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-3-(2-methylbenzimidazol-1-yl)propan-1-one |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)CCn1c(C)nc3ccccc31)CC2 |
| InChI | InChI=1S/C20H27N3O3/c1-14-21-16-5-3-4-6-17(16)22(14)11-8-19(25)23-12-10-20(26-2)9-7-15(24)13-18(20)23/h3-6,15,18,24H,7-13H2,1-2H3/t15-,18-,20+/m0/s1 |
| InChIKey | ZSDMSWDOUKNRCC-ZAAXVRCTSA-N |
| XLogP | 2.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |