C14H21N3O2 — CID 119065530
(3aR,6R,7aS)-3a-methoxy-1-(pyridazin-3-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 119065530) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (3aR,6R,7aS)-3a-methoxy-1-(pyridazin-3-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aR,6R,7aS)-3a-methoxy-1-(pyridazin-3-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 119065530 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (3aR,6R,7aS)-3a-methoxy-1-(pyridazin-3-ylmethyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | CO[C@@]12CC[C@@H](O)C[C@@H]1N(Cc1cccnn1)CC2 |
| InChI | InChI=1S/C14H21N3O2/c1-19-14-5-4-12(18)9-13(14)17(8-6-14)10-11-3-2-7-15-16-11/h2-3,7,12-13,18H,4-6,8-10H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | ALYHSGZJYLLSRA-HZSPNIEDSA-N |
| XLogP | 0.98 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |