C21H33NO4 — CID 119064553
(3aR,6S,7aS)-1-[(2,4-diethoxy-3-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol (PubChem CID 119064553) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is (3aR,6S,7aS)-1-[(2,4-diethoxy-3-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol.
| Compound Name | (3aR,6S,7aS)-1-[(2,4-diethoxy-3-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
|---|---|
| PubChem CID | 119064553 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (3aR,6S,7aS)-1-[(2,4-diethoxy-3-methylphenyl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-ol |
| SMILES | CCOc1ccc(CN2CC[C@]3(OC)CC[C@H](O)C[C@H]23)c(OCC)c1C |
| InChI | InChI=1S/C21H33NO4/c1-5-25-18-8-7-16(20(15(18)3)26-6-2)14-22-12-11-21(24-4)10-9-17(23)13-19(21)22/h7-8,17,19,23H,5-6,9-14H2,1-4H3/t17-,19-,21+/m0/s1 |
| InChIKey | XRIFHKXXDNCWAX-HFSMHLIXSA-N |
| XLogP | 3.30 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |