C18H32Cl2N2O2 — CID 154900992
1-[(2,4-diethoxy-3-methylphenyl)methyl]azepan-4-amine;dihydrochloride (PubChem CID 154900992) has the molecular formula C18H32Cl2N2O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[(2,4-diethoxy-3-methylphenyl)methyl]azepan-4-amine;dihydrochloride.
| Compound Name | 1-[(2,4-diethoxy-3-methylphenyl)methyl]azepan-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154900992 |
| Molecular Formula | C18H32Cl2N2O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[(2,4-diethoxy-3-methylphenyl)methyl]azepan-4-amine;dihydrochloride |
| SMILES | CCOc1ccc(CN2CCCC(N)CC2)c(OCC)c1C.Cl.Cl |
| InChI | InChI=1S/C18H30N2O2.2ClH/c1-4-21-17-9-8-15(18(14(17)3)22-5-2)13-20-11-6-7-16(19)10-12-20;;/h8-9,16H,4-7,10-13,19H2,1-3H3;2*1H |
| InChIKey | BUTJXNOLCPOWOM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |