C15H26Cl2N2O2 — CID 154900743
2-[2-[(4-aminoazepan-1-yl)methyl]phenoxy]ethanol;dihydrochloride (PubChem CID 154900743) has the molecular formula C15H26Cl2N2O2 and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-[2-[(4-aminoazepan-1-yl)methyl]phenoxy]ethanol;dihydrochloride.
| Compound Name | 2-[2-[(4-aminoazepan-1-yl)methyl]phenoxy]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 154900743 |
| Molecular Formula | C15H26Cl2N2O2 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-[2-[(4-aminoazepan-1-yl)methyl]phenoxy]ethanol;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(Cc2ccccc2OCCO)CC1 |
| InChI | InChI=1S/C15H24N2O2.2ClH/c16-14-5-3-8-17(9-7-14)12-13-4-1-2-6-15(13)19-11-10-18;;/h1-2,4,6,14,18H,3,5,7-12,16H2;2*1H |
| InChIKey | PXXSNDACFIQQRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |