C15H23NO4 — CID 95891655
(3S)-1-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-(hydroxymethyl)piperidin-3-ol (PubChem CID 95891655) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (3S)-1-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-(hydroxymethyl)piperidin-3-ol.
| Compound Name | (3S)-1-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 95891655 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (3S)-1-[[2-(2-hydroxyethoxy)phenyl]methyl]-3-(hydroxymethyl)piperidin-3-ol |
| SMILES | OCCOc1ccccc1CN1CCC[C@@](O)(CO)C1 |
| InChI | InChI=1S/C15H23NO4/c17-8-9-20-14-5-2-1-4-13(14)10-16-7-3-6-15(19,11-16)12-18/h1-2,4-5,17-19H,3,6-12H2/t15-/m0/s1 |
| InChIKey | MTIVAAOPBIBZSX-HNNXBMFYSA-N |
| XLogP | 0.38 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |