C24H33NO3 — CID 26404101
2-[2-[[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]methyl]phenoxy]ethanol (PubChem CID 26404101) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[2-[[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[2-[[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 26404101 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-[2-[[(3R)-3-(hydroxymethyl)-3-(3-phenylpropyl)piperidin-1-yl]methyl]phenoxy]ethanol |
| SMILES | OCCOc1ccccc1CN1CCC[C@](CO)(CCCc2ccccc2)C1 |
| InChI | InChI=1S/C24H33NO3/c26-16-17-28-23-12-5-4-11-22(23)18-25-15-7-14-24(19-25,20-27)13-6-10-21-8-2-1-3-9-21/h1-5,8-9,11-12,26-27H,6-7,10,13-20H2/t24-/m1/s1 |
| InChIKey | NIVINOPMHHLNFP-XMMPIXPASA-N |
| XLogP | 3.66 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |