C17H27NO4 — CID 95707159
(4R)-4-(hydroxymethyl)-1-[3-(2-methoxyphenoxy)propyl]azepan-4-ol (PubChem CID 95707159) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is (4R)-4-(hydroxymethyl)-1-[3-(2-methoxyphenoxy)propyl]azepan-4-ol.
| Compound Name | (4R)-4-(hydroxymethyl)-1-[3-(2-methoxyphenoxy)propyl]azepan-4-ol |
|---|---|
| PubChem CID | 95707159 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (4R)-4-(hydroxymethyl)-1-[3-(2-methoxyphenoxy)propyl]azepan-4-ol |
| SMILES | COc1ccccc1OCCCN1CCC[C@](O)(CO)CC1 |
| InChI | InChI=1S/C17H27NO4/c1-21-15-6-2-3-7-16(15)22-13-5-11-18-10-4-8-17(20,14-19)9-12-18/h2-3,6-7,19-20H,4-5,8-14H2,1H3/t17-/m1/s1 |
| InChIKey | YZRMMQDGNVBQJT-QGZVFWFLSA-N |
| XLogP | 1.67 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|