C16H22F3NO2 — CID 121418449
4-methyl-1-[3-[2-(trifluoromethyl)phenoxy]propyl]piperidin-4-ol (PubChem CID 121418449) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-methyl-1-[3-[2-(trifluoromethyl)phenoxy]propyl]piperidin-4-ol.
| Compound Name | 4-methyl-1-[3-[2-(trifluoromethyl)phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 121418449 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-methyl-1-[3-[2-(trifluoromethyl)phenoxy]propyl]piperidin-4-ol |
| SMILES | CC1(O)CCN(CCCOc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3NO2/c1-15(21)7-10-20(11-8-15)9-4-12-22-14-6-3-2-5-13(14)16(17,18)19/h2-3,5-6,21H,4,7-12H2,1H3 |
| InChIKey | FLITWOFCKRHAIY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|