C22H33ClN2O3 — CID 171667448
7-bicyclo[4.1.0]heptanyl-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]methanone;hydrochloride (PubChem CID 171667448) has the molecular formula C22H33ClN2O3 and a molecular weight of 408.97 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]methanone;hydrochloride.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 171667448 |
| Molecular Formula | C22H33ClN2O3 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-[4-[3-(2-methoxyphenoxy)propyl]piperazin-1-yl]methanone;hydrochloride |
| SMILES | COc1ccccc1OCCCN1CCN(C(=O)C2C3CCCCC32)CC1.Cl |
| InChI | InChI=1S/C22H32N2O3.ClH/c1-26-19-9-4-5-10-20(19)27-16-6-11-23-12-14-24(15-13-23)22(25)21-17-7-2-3-8-18(17)21;/h4-5,9-10,17-18,21H,2-3,6-8,11-16H2,1H3;1H |
| InChIKey | QCGZXLFHNPDHEY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|