C20H31NO4 — CID 118772693
(3aR,6S,7aS)-3a,6-dimethoxy-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118772693) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a,6-dimethoxy-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118772693 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[[4-methoxy-3-(methoxymethyl)phenyl]methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COCc1cc(CN2CC[C@]3(OC)CC[C@H](OC)C[C@H]23)ccc1OC |
| InChI | InChI=1S/C20H31NO4/c1-22-14-16-11-15(5-6-18(16)24-3)13-21-10-9-20(25-4)8-7-17(23-2)12-19(20)21/h5-6,11,17,19H,7-10,12-14H2,1-4H3/t17-,19-,20+/m0/s1 |
| InChIKey | PCZYYLVQYFGCNZ-YSIASYRMSA-N |
| XLogP | 3.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |