C20H29NO3 — CID 118763436
(3aR,6S,7aS)-3a,6-dimethoxy-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 118763436) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a,6-dimethoxy-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 118763436 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1ccccc1/C=C/CN1CC[C@]2(OC)CC[C@H](OC)C[C@H]12 |
| InChI | InChI=1S/C20H29NO3/c1-22-17-10-11-20(24-3)12-14-21(19(20)15-17)13-6-8-16-7-4-5-9-18(16)23-2/h4-9,17,19H,10-15H2,1-3H3/b8-6+/t17-,19-,20+/m0/s1 |
| InChIKey | CMXOPNAJWQKWRE-XVHGGAPTSA-N |
| XLogP | 3.37 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |