C22H31N3O2 — CID 119073324
(3aR,6R,7aS)-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119073324) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (3aR,6R,7aS)-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6R,7aS)-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119073324 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (3aR,6R,7aS)-1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(Cc3c(C)nn(-c4ccccc4)c3C)[C@H]2C1 |
| InChI | InChI=1S/C22H31N3O2/c1-16-20(17(2)25(23-16)18-8-6-5-7-9-18)15-24-13-12-22(27-4)11-10-19(26-3)14-21(22)24/h5-9,19,21H,10-15H2,1-4H3/t19-,21+,22-/m1/s1 |
| InChIKey | DNMBOWNLFLEZLM-BAGYTPMASA-N |
| XLogP | 3.65 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |