C19H29NO3 — CID 119059593
(3aR,6S,7aS)-3a,6-dimethoxy-1-[(4-methoxy-2-methylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole (PubChem CID 119059593) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a,6-dimethoxy-1-[(4-methoxy-2-methylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole.
| Compound Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[(4-methoxy-2-methylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
|---|---|
| PubChem CID | 119059593 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (3aR,6S,7aS)-3a,6-dimethoxy-1-[(4-methoxy-2-methylphenyl)methyl]-3,4,5,6,7,7a-hexahydro-2H-indole |
| SMILES | COc1ccc(CN2CC[C@]3(OC)CC[C@H](OC)C[C@H]23)c(C)c1 |
| InChI | InChI=1S/C19H29NO3/c1-14-11-16(21-2)6-5-15(14)13-20-10-9-19(23-4)8-7-17(22-3)12-18(19)20/h5-6,11,17-18H,7-10,12-13H2,1-4H3/t17-,18-,19+/m0/s1 |
| InChIKey | MHYBAOIQKZBBIY-GBESFXJTSA-N |
| XLogP | 3.16 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |