C21H31NO4 — CID 119073545
1-[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-methoxyphenyl)butan-1-one (PubChem CID 119073545) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-methoxyphenyl)butan-1-one.
| Compound Name | 1-[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-methoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 119073545 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-methoxyphenyl)butan-1-one |
| SMILES | COc1ccc(CCCC(=O)N2CC[C@]3(OC)CC[C@H](OC)C[C@H]23)cc1 |
| InChI | InChI=1S/C21H31NO4/c1-24-17-9-7-16(8-10-17)5-4-6-20(23)22-14-13-21(26-3)12-11-18(25-2)15-19(21)22/h7-10,18-19H,4-6,11-15H2,1-3H3/t18-,19-,21+/m0/s1 |
| InChIKey | JXEATLZWISIJAV-IRFCIJBXSA-N |
| XLogP | 3.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |