C22H33NO3 — CID 119065679
1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-ethylphenyl)butan-1-one (PubChem CID 119065679) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-ethylphenyl)butan-1-one.
| Compound Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-ethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 119065679 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-4-(4-ethylphenyl)butan-1-one |
| SMILES | CCc1ccc(CCCC(=O)N2CC[C@]3(OC)CC[C@@H](OC)C[C@H]23)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-4-17-8-10-18(11-9-17)6-5-7-21(24)23-15-14-22(26-3)13-12-19(25-2)16-20(22)23/h8-11,19-20H,4-7,12-16H2,1-3H3/t19-,20+,22-/m1/s1 |
| InChIKey | MSLSHHNHYQIAAK-RZUBCFFCSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |