C17H21F2NO3 — CID 118767909
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2,5-difluorophenyl)methanone (PubChem CID 118767909) has the molecular formula C17H21F2NO3 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2,5-difluorophenyl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 118767909 |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2,5-difluorophenyl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3cc(F)ccc3F)[C@H]2C1 |
| InChI | InChI=1S/C17H21F2NO3/c1-22-12-5-6-17(23-2)7-8-20(15(17)10-12)16(21)13-9-11(18)3-4-14(13)19/h3-4,9,12,15H,5-8,10H2,1-2H3/t12-,15-,17+/m0/s1 |
| InChIKey | FIWIBOFYJVEKAD-YLQAJVPDSA-N |
| XLogP | 2.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |