C17H22FNO3 — CID 119064238
[(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-fluoro-2-methylphenyl)methanone (PubChem CID 119064238) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-fluoro-2-methylphenyl)methanone.
| Compound Name | [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 119064238 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [(3aR,6R,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-fluoro-2-methylphenyl)methanone |
| SMILES | CO[C@@]12CC[C@@H](O)C[C@@H]1N(C(=O)c1ccc(F)cc1C)CC2 |
| InChI | InChI=1S/C17H22FNO3/c1-11-9-12(18)3-4-14(11)16(21)19-8-7-17(22-2)6-5-13(20)10-15(17)19/h3-4,9,13,15,20H,5-8,10H2,1-2H3/t13-,15+,17-/m1/s1 |
| InChIKey | DVTHUUHMPCZUAU-UKPHBRMFSA-N |
| XLogP | 2.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |