C17H21N5O3 — CID 118794359
[(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone (PubChem CID 118794359) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 118794359 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(3aR,6S,7aS)-6-hydroxy-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(tetrazol-1-yl)phenyl]methanone |
| SMILES | CO[C@@]12CC[C@H](O)C[C@@H]1N(C(=O)c1ccc(-n3cnnn3)cc1)CC2 |
| InChI | InChI=1S/C17H21N5O3/c1-25-17-7-6-14(23)10-15(17)21(9-8-17)16(24)12-2-4-13(5-3-12)22-11-18-19-20-22/h2-5,11,14-15,23H,6-10H2,1H3/t14-,15-,17+/m0/s1 |
| InChIKey | HHFOQDIRENDEAU-YQQAZPJKSA-N |
| XLogP | 0.81 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |