C20H30N2O4 — CID 119067303
[(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(dimethylamino)phenyl]methanone (PubChem CID 119067303) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(dimethylamino)phenyl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 119067303 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [(3aR,6S,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(dimethylamino)phenyl]methanone |
| SMILES | CO[C@@]12CC[C@H](OCCO)C[C@@H]1N(C(=O)c1ccc(N(C)C)cc1)CC2 |
| InChI | InChI=1S/C20H30N2O4/c1-21(2)16-6-4-15(5-7-16)19(24)22-11-10-20(25-3)9-8-17(14-18(20)22)26-13-12-23/h4-7,17-18,23H,8-14H2,1-3H3/t17-,18-,20+/m0/s1 |
| InChIKey | PFCZCILBTGGNOX-CMKODMSKSA-N |
| XLogP | 1.91 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |