C21H30N2O3 — CID 118782946
[(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(aminomethyl)phenyl]methanone (PubChem CID 118782946) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(aminomethyl)phenyl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(aminomethyl)phenyl]methanone |
|---|---|
| PubChem CID | 118782946 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[4-(aminomethyl)phenyl]methanone |
| SMILES | CO[C@@]12CC[C@H](OCC3CC3)C[C@@H]1N(C(=O)c1ccc(CN)cc1)CC2 |
| InChI | InChI=1S/C21H30N2O3/c1-25-21-9-8-18(26-14-16-2-3-16)12-19(21)23(11-10-21)20(24)17-6-4-15(13-22)5-7-17/h4-7,16,18-19H,2-3,8-14,22H2,1H3/t18-,19-,21+/m0/s1 |
| InChIKey | QYKSOUXHKMNMRN-IRFCIJBXSA-N |
| XLogP | 2.72 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |