C20H29NO4S — CID 119065406
[(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone (PubChem CID 119065406) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone.
| Compound Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 119065406 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-[5-(methylsulfanylmethyl)furan-2-yl]methanone |
| SMILES | CO[C@@]12CC[C@H](OCC3CC3)C[C@@H]1N(C(=O)c1ccc(CSC)o1)CC2 |
| InChI | InChI=1S/C20H29NO4S/c1-23-20-8-7-15(24-12-14-3-4-14)11-18(20)21(10-9-20)19(22)17-6-5-16(25-17)13-26-2/h5-6,14-15,18H,3-4,7-13H2,1-2H3/t15-,18-,20+/m0/s1 |
| InChIKey | IIMIFLOFKRHOSX-ZAAXVRCTSA-N |
| XLogP | 3.72 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |