C24H30N2O3 — CID 119061079
[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylquinolin-4-yl)methanone (PubChem CID 119061079) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is [(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylquinolin-4-yl)methanone.
| Compound Name | [(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 119061079 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(6-methylquinolin-4-yl)methanone |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(C(=O)c1ccnc3ccc(C)cc13)CC2 |
| InChI | InChI=1S/C24H30N2O3/c1-16-3-6-21-20(13-16)19(8-11-25-21)23(27)26-12-10-24(28-2)9-7-18(14-22(24)26)29-15-17-4-5-17/h3,6,8,11,13,17-18,22H,4-5,7,9-10,12,14-15H2,1-2H3/t18-,22+,24-/m1/s1 |
| InChIKey | WYDFZSUFBAKLCF-RVSNTGDXSA-N |
| XLogP | 4.12 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |