C15H22N2O3S — CID 119071345
[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 119071345) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 119071345 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)c3scnc3C)[C@H]2C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-10-13(21-9-16-10)14(18)17-7-6-15(20-3)5-4-11(19-2)8-12(15)17/h9,11-12H,4-8H2,1-3H3/t11-,12+,15-/m1/s1 |
| InChIKey | OWHUJPNKRYTSHG-TYNCELHUSA-N |
| XLogP | 2.25 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |