C21H25NO4 — CID 118780714
[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-benzoxepin-4-yl)methanone (PubChem CID 118780714) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-benzoxepin-4-yl)methanone.
| Compound Name | [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-benzoxepin-4-yl)methanone |
|---|---|
| PubChem CID | 118780714 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1-benzoxepin-4-yl)methanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)C3=Cc4ccccc4OC=C3)[C@H]2C1 |
| InChI | InChI=1S/C21H25NO4/c1-24-17-7-9-21(25-2)10-11-22(19(21)14-17)20(23)16-8-12-26-18-6-4-3-5-15(18)13-16/h3-6,8,12-13,17,19H,7,9-11,14H2,1-2H3/t17-,19+,21-/m1/s1 |
| InChIKey | ICMHEPJDRLIZQI-SLYNCCJLSA-N |
| XLogP | 3.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |