C20H26N2O3 — CID 118780460
1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(1H-indol-3-yl)ethanone (PubChem CID 118780460) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 118780460 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(1H-indol-3-yl)ethanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)Cc3c[nH]c4ccccc34)[C@H]2C1 |
| InChI | InChI=1S/C20H26N2O3/c1-24-15-7-8-20(25-2)9-10-22(18(20)12-15)19(23)11-14-13-21-17-6-4-3-5-16(14)17/h3-6,13,15,18,21H,7-12H2,1-2H3/t15-,18+,20-/m1/s1 |
| InChIKey | SHJSSRZRLOJGPH-MOXGXCLJSA-N |
| XLogP | 2.90 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |