C21H31NO3 — CID 119068523
1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-propan-2-ylphenyl)ethanone (PubChem CID 119068523) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-propan-2-ylphenyl)ethanone.
| Compound Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-propan-2-ylphenyl)ethanone |
|---|---|
| PubChem CID | 119068523 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-propan-2-ylphenyl)ethanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)Cc3ccc(C(C)C)cc3)[C@H]2C1 |
| InChI | InChI=1S/C21H31NO3/c1-15(2)17-7-5-16(6-8-17)13-20(23)22-12-11-21(25-4)10-9-18(24-3)14-19(21)22/h5-8,15,18-19H,9-14H2,1-4H3/t18-,19+,21-/m1/s1 |
| InChIKey | RZXHCMZZDXTGJK-SVFBPWRDSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |