C22H30FNO3 — CID 119073607
1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-fluoro-3-methylphenyl)ethanone (PubChem CID 119073607) has the molecular formula C22H30FNO3 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-fluoro-3-methylphenyl)ethanone.
| Compound Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-fluoro-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 119073607 |
| Molecular Formula | C22H30FNO3 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(4-fluoro-3-methylphenyl)ethanone |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(C(=O)Cc1ccc(F)c(C)c1)CC2 |
| InChI | InChI=1S/C22H30FNO3/c1-15-11-17(5-6-19(15)23)12-21(25)24-10-9-22(26-2)8-7-18(13-20(22)24)27-14-16-3-4-16/h5-6,11,16,18,20H,3-4,7-10,12-14H2,1-2H3/t18-,20+,22-/m1/s1 |
| InChIKey | FOUQHXKTSLJNQG-KAGYGMCKSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |