C21H27F2NO3 — CID 119070041
1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(3,5-difluorophenyl)ethanone (PubChem CID 119070041) has the molecular formula C21H27F2NO3 and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 119070041 |
| Molecular Formula | C21H27F2NO3 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-(3,5-difluorophenyl)ethanone |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(C(=O)Cc1cc(F)cc(F)c1)CC2 |
| InChI | InChI=1S/C21H27F2NO3/c1-26-21-5-4-18(27-13-14-2-3-14)12-19(21)24(7-6-21)20(25)10-15-8-16(22)11-17(23)9-15/h8-9,11,14,18-19H,2-7,10,12-13H2,1H3/t18-,19+,21-/m1/s1 |
| InChIKey | ICBYWOWHIARGRD-SVFBPWRDSA-N |
| XLogP | 3.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |