C22H31NO4 — CID 119067842
[(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methoxy-6-methylphenyl)methanone (PubChem CID 119067842) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methoxy-6-methylphenyl)methanone.
| Compound Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methoxy-6-methylphenyl)methanone |
|---|---|
| PubChem CID | 119067842 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | [(3aR,6S,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(2-methoxy-6-methylphenyl)methanone |
| SMILES | COc1cccc(C)c1C(=O)N1CC[C@]2(OC)CC[C@H](OCC3CC3)C[C@H]12 |
| InChI | InChI=1S/C22H31NO4/c1-15-5-4-6-18(25-2)20(15)21(24)23-12-11-22(26-3)10-9-17(13-19(22)23)27-14-16-7-8-16/h4-6,16-17,19H,7-14H2,1-3H3/t17-,19-,22+/m0/s1 |
| InChIKey | BBLQCXLQTBTEPR-LQBOVUBWSA-N |
| XLogP | 3.58 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |