C21H28FNO4 — CID 156608067
[6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-fluoro-2-methoxyphenyl)methanone (PubChem CID 156608067) has the molecular formula C21H28FNO4 and a molecular weight of 377.46 g/mol. Its IUPAC name is [6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-fluoro-2-methoxyphenyl)methanone.
| Compound Name | [6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-fluoro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 156608067 |
| Molecular Formula | C21H28FNO4 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(5-fluoro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(F)cc1C(=O)N1CCC2(OC)CCC(OCC3CC3)CC12 |
| InChI | InChI=1S/C21H28FNO4/c1-25-18-6-5-15(22)11-17(18)20(24)23-10-9-21(26-2)8-7-16(12-19(21)23)27-13-14-3-4-14/h5-6,11,14,16,19H,3-4,7-10,12-13H2,1-2H3 |
| InChIKey | HIDRWSMRVYKSPN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |