C21H29NO4 — CID 119065202
1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-phenoxyethanone (PubChem CID 119065202) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 119065202 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-phenoxyethanone |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(C(=O)COc1ccccc1)CC2 |
| InChI | InChI=1S/C21H29NO4/c1-24-21-10-9-18(25-14-16-7-8-16)13-19(21)22(12-11-21)20(23)15-26-17-5-3-2-4-6-17/h2-6,16,18-19H,7-15H2,1H3/t18-,19+,21-/m1/s1 |
| InChIKey | GXXNJZOECWLBBZ-SVFBPWRDSA-N |
| XLogP | 3.03 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |