C22H32N2O3 — CID 119065281
2-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-N-benzylacetamide (PubChem CID 119065281) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-N-benzylacetamide.
| Compound Name | 2-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 119065281 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[(3aR,6R,7aS)-6-(cyclopropylmethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-N-benzylacetamide |
| SMILES | CO[C@@]12CC[C@@H](OCC3CC3)C[C@@H]1N(CC(=O)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C22H32N2O3/c1-26-22-10-9-19(27-16-18-7-8-18)13-20(22)24(12-11-22)15-21(25)23-14-17-5-3-2-4-6-17/h2-6,18-20H,7-16H2,1H3,(H,23,25)/t19-,20+,22-/m1/s1 |
| InChIKey | XTFLLERMMXHKLL-RZUBCFFCSA-N |
| XLogP | 2.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |