C17H24N2O3S — CID 119066345
1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-pyridin-2-ylsulfanylethanone (PubChem CID 119066345) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-pyridin-2-ylsulfanylethanone.
| Compound Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-pyridin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 119066345 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-[(3aR,6R,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-2-pyridin-2-ylsulfanylethanone |
| SMILES | CO[C@@H]1CC[C@@]2(OC)CCN(C(=O)CSc3ccccn3)[C@H]2C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-21-13-6-7-17(22-2)8-10-19(14(17)11-13)16(20)12-23-15-5-3-4-9-18-15/h3-5,9,13-14H,6-8,10-12H2,1-2H3/t13-,14+,17-/m1/s1 |
| InChIKey | AXLFORZZDRUWQN-JKIFEVAISA-N |
| XLogP | 2.36 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |