C20H25N3O3 — CID 118794106
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-pyrazol-1-ylphenyl)methanone (PubChem CID 118794106) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-pyrazol-1-ylphenyl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-pyrazol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 118794106 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(4-pyrazol-1-ylphenyl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3ccc(-n4cccn4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C20H25N3O3/c1-25-17-8-9-20(26-2)10-13-22(18(20)14-17)19(24)15-4-6-16(7-5-15)23-12-3-11-21-23/h3-7,11-12,17-18H,8-10,13-14H2,1-2H3/t17-,18-,20+/m0/s1 |
| InChIKey | ZDCRPHJAPSRFBX-CMKODMSKSA-N |
| XLogP | 2.67 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |