C14H21N3O3 — CID 119070558
[(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1H-imidazol-5-yl)methanone (PubChem CID 119070558) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1H-imidazol-5-yl)methanone.
| Compound Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1H-imidazol-5-yl)methanone |
|---|---|
| PubChem CID | 119070558 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [(3aR,6S,7aS)-3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl]-(1H-imidazol-5-yl)methanone |
| SMILES | CO[C@H]1CC[C@@]2(OC)CCN(C(=O)c3cnc[nH]3)[C@H]2C1 |
| InChI | InChI=1S/C14H21N3O3/c1-19-10-3-4-14(20-2)5-6-17(12(14)7-10)13(18)11-8-15-9-16-11/h8-10,12H,3-7H2,1-2H3,(H,15,16)/t10-,12-,14+/m0/s1 |
| InChIKey | GUORTAKSMRIVRN-VHRBIJSZSA-N |
| XLogP | 1.21 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |