C17H24N2O5 — CID 118790718
5-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1H-pyridin-2-one (PubChem CID 118790718) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 5-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118790718 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 5-[(3aR,6R,7aS)-6-(2-hydroxyethoxy)-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indole-1-carbonyl]-1H-pyridin-2-one |
| SMILES | CO[C@@]12CC[C@@H](OCCO)C[C@@H]1N(C(=O)c1ccc(=O)[nH]c1)CC2 |
| InChI | InChI=1S/C17H24N2O5/c1-23-17-5-4-13(24-9-8-20)10-14(17)19(7-6-17)16(22)12-2-3-15(21)18-11-12/h2-3,11,13-14,20H,4-10H2,1H3,(H,18,21)/t13-,14+,17-/m1/s1 |
| InChIKey | DYTMOTJYTNKNGP-JKIFEVAISA-N |
| XLogP | 0.54 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |